C26H36ClN3O — CID 2143746
2,6-ditert-butyl-4-[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]iminomethyl]phenol (PubChem CID 2143746) has the molecular formula C26H36ClN3O and a molecular weight of 442.05 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]iminomethyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 2143746 |
| Molecular Formula | C26H36ClN3O |
| Molecular Weight | 442.05 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | 2,6-ditert-butyl-4-[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]iminomethyl]phenol |
| SMILES | CC(C)(C)c1cc(C=NN2CCN(Cc3ccc(Cl)cc3)CC2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C26H36ClN3O/c1-25(2,3)22-15-20(16-23(24(22)31)26(4,5)6)17-28-30-13-11-29(12-14-30)18-19-7-9-21(27)10-8-19/h7-10,15-17,31H,11-14,18H2,1-6H3 |
| InChIKey | DMOZLAGCWRPREW-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 39.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.05 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|