C24H24Cl2N2O3 — CID 46933339
6-(chloromethyl)-2-[[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]methyl]-3-hydroxypyran-4-one (PubChem CID 46933339) has the molecular formula C24H24Cl2N2O3 and a molecular weight of 459.37 g/mol. Its IUPAC name is 6-(chloromethyl)-2-[[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]methyl]-3-hydroxypyran-4-one.
| Compound Name | 6-(chloromethyl)-2-[[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]methyl]-3-hydroxypyran-4-one |
|---|---|
| PubChem CID | 46933339 |
| Molecular Formula | C24H24Cl2N2O3 |
| Molecular Weight | 459.37 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 6-(chloromethyl)-2-[[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]methyl]-3-hydroxypyran-4-one |
| SMILES | O=c1cc(CCl)oc(CN2CCN(C(c3ccccc3)c3ccc(Cl)cc3)CC2)c1O |
| InChI | InChI=1S/C24H24Cl2N2O3/c25-15-20-14-21(29)24(30)22(31-20)16-27-10-12-28(13-11-27)23(17-4-2-1-3-5-17)18-6-8-19(26)9-7-18/h1-9,14,23,30H,10-13,15-16H2 |
| InChIKey | ZYSKBWRPXABPCJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|