C24H24F2N2O3 — CID 71704296
2-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]methyl]-3-hydroxy-6-methylpyran-4-one (PubChem CID 71704296) has the molecular formula C24H24F2N2O3 and a molecular weight of 426.46 g/mol. Its IUPAC name is 2-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]methyl]-3-hydroxy-6-methylpyran-4-one.
| Compound Name | 2-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]methyl]-3-hydroxy-6-methylpyran-4-one |
|---|---|
| PubChem CID | 71704296 |
| Molecular Formula | C24H24F2N2O3 |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]methyl]-3-hydroxy-6-methylpyran-4-one |
| SMILES | Cc1cc(=O)c(O)c(CN2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)o1 |
| InChI | InChI=1S/C24H24F2N2O3/c1-16-14-21(29)24(30)22(31-16)15-27-10-12-28(13-11-27)23(17-2-6-19(25)7-3-17)18-4-8-20(26)9-5-18/h2-9,14,23,30H,10-13,15H2,1H3 |
| InChIKey | QFGBIRMTZNQBIG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |