C24H24F2N2O3 — CID 24626996
methyl 2-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]methyl]furan-3-carboxylate (PubChem CID 24626996) has the molecular formula C24H24F2N2O3 and a molecular weight of 426.46 g/mol. Its IUPAC name is methyl 2-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]methyl]furan-3-carboxylate.
| Compound Name | methyl 2-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 24626996 |
| Molecular Formula | C24H24F2N2O3 |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | methyl 2-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1ccoc1CN1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H24F2N2O3/c1-30-24(29)21-10-15-31-22(21)16-27-11-13-28(14-12-27)23(17-2-6-19(25)7-3-17)18-4-8-20(26)9-5-18/h2-10,15,23H,11-14,16H2,1H3 |
| InChIKey | QJLTWLVLHOZYHX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |