C14H19NO5 — CID 79038546
methyl (3S)-1-[(3-methoxycarbonylfuran-2-yl)methyl]piperidine-3-carboxylate (PubChem CID 79038546) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is methyl (3S)-1-[(3-methoxycarbonylfuran-2-yl)methyl]piperidine-3-carboxylate.
| Compound Name | methyl (3S)-1-[(3-methoxycarbonylfuran-2-yl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 79038546 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | methyl (3S)-1-[(3-methoxycarbonylfuran-2-yl)methyl]piperidine-3-carboxylate |
| SMILES | COC(=O)c1ccoc1CN1CCC[C@H](C(=O)OC)C1 |
| InChI | InChI=1S/C14H19NO5/c1-18-13(16)10-4-3-6-15(8-10)9-12-11(5-7-20-12)14(17)19-2/h5,7,10H,3-4,6,8-9H2,1-2H3/t10-/m0/s1 |
| InChIKey | VSNXUHXMEFVILR-JTQLQIEISA-N |
| XLogP | 1.45 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |