C12H17NO3 — CID 43477695
2-[(3-methylpiperidin-1-yl)methyl]furan-3-carboxylic acid (PubChem CID 43477695) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-[(3-methylpiperidin-1-yl)methyl]furan-3-carboxylic acid.
| Compound Name | 2-[(3-methylpiperidin-1-yl)methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 43477695 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 2-[(3-methylpiperidin-1-yl)methyl]furan-3-carboxylic acid |
| SMILES | CC1CCCN(Cc2occc2C(=O)O)C1 |
| InChI | InChI=1S/C12H17NO3/c1-9-3-2-5-13(7-9)8-11-10(12(14)15)4-6-16-11/h4,6,9H,2-3,5,7-8H2,1H3,(H,14,15) |
| InChIKey | HPUGTZJHKNZUCV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |