C13H19NO4 — CID 51072760
ethyl 2-[(3-hydroxypiperidin-1-yl)methyl]furan-3-carboxylate (PubChem CID 51072760) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is ethyl 2-[(3-hydroxypiperidin-1-yl)methyl]furan-3-carboxylate.
| Compound Name | ethyl 2-[(3-hydroxypiperidin-1-yl)methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 51072760 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | ethyl 2-[(3-hydroxypiperidin-1-yl)methyl]furan-3-carboxylate |
| SMILES | CCOC(=O)c1ccoc1CN1CCCC(O)C1 |
| InChI | InChI=1S/C13H19NO4/c1-2-17-13(16)11-5-7-18-12(11)9-14-6-3-4-10(15)8-14/h5,7,10,15H,2-4,6,8-9H2,1H3 |
| InChIKey | LCYZQRCUACLCDB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |