C14H23N3O3 — CID 80506842
ethyl 2-[[2-(aminomethyl)-4-methylpiperazin-1-yl]methyl]furan-3-carboxylate (PubChem CID 80506842) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is ethyl 2-[[2-(aminomethyl)-4-methylpiperazin-1-yl]methyl]furan-3-carboxylate.
| Compound Name | ethyl 2-[[2-(aminomethyl)-4-methylpiperazin-1-yl]methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 80506842 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | ethyl 2-[[2-(aminomethyl)-4-methylpiperazin-1-yl]methyl]furan-3-carboxylate |
| SMILES | CCOC(=O)c1ccoc1CN1CCN(C)CC1CN |
| InChI | InChI=1S/C14H23N3O3/c1-3-19-14(18)12-4-7-20-13(12)10-17-6-5-16(2)9-11(17)8-15/h4,7,11H,3,5-6,8-10,15H2,1-2H3 |
| InChIKey | VUGNHTHZYQWVFU-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |