C16H24N2O3 — CID 66242754
ethyl 2-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]furan-3-carboxylate (PubChem CID 66242754) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is ethyl 2-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]furan-3-carboxylate.
| Compound Name | ethyl 2-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 66242754 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | ethyl 2-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]furan-3-carboxylate |
| SMILES | CCOC(=O)c1ccoc1CN1CC2CNCC2C1(C)C |
| InChI | InChI=1S/C16H24N2O3/c1-4-20-15(19)12-5-6-21-14(12)10-18-9-11-7-17-8-13(11)16(18,2)3/h5-6,11,13,17H,4,7-10H2,1-3H3 |
| InChIKey | KKLUIOZQMIPVLK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |