C19H21NO4 — CID 18150309
methyl 2-[(4-benzoylpiperidin-1-yl)methyl]furan-3-carboxylate (PubChem CID 18150309) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is methyl 2-[(4-benzoylpiperidin-1-yl)methyl]furan-3-carboxylate.
| Compound Name | methyl 2-[(4-benzoylpiperidin-1-yl)methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 18150309 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | methyl 2-[(4-benzoylpiperidin-1-yl)methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1ccoc1CN1CCC(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H21NO4/c1-23-19(22)16-9-12-24-17(16)13-20-10-7-15(8-11-20)18(21)14-5-3-2-4-6-14/h2-6,9,12,15H,7-8,10-11,13H2,1H3 |
| InChIKey | MIXRUTVIIBPRLT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |