About methyl (3S)-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylate
methyl (3S)-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylate (PubChem CID 79046872) has the molecular formula C11H16N2O3
and a molecular weight of 224.26 g/mol. Its IUPAC name is methyl (3S)-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylate.
Analyze methyl (3S)-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylate?
The IUPAC name of methyl (3S)-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylate (CID 79046872) is methyl (3S)-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylate.
What is the SMILES notation for methyl (3S)-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylate?
The canonical SMILES for methyl (3S)-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylate is COC(=O)[C@H]1CCCN(Cc2ccno2)C1.
What is the InChIKey of methyl (3S)-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylate?
The InChIKey is DHVNRYCNXBVXNA-VIFPVBQESA-N. The full InChI is InChI=1S/C11H16N2O3/c1-15-11(14)9-3-2-6-13(7-9)8-10-4-5-12-16-10/h4-5,9H,2-3,6-8H2,1H3/t9-/m0/s1.
What are the key properties of methyl (3S)-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylate?
methyl (3S)-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylate has a molecular weight of 224.26 g/mol, XLogP of 1.06, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-1-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxylate is sourced from PubChem (CID 79046872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).