C14H17BrFNO2 — CID 79673422
methyl 1-[(3-bromo-5-fluorophenyl)methyl]piperidine-3-carboxylate (PubChem CID 79673422) has the molecular formula C14H17BrFNO2 and a molecular weight of 330.20 g/mol. Its IUPAC name is methyl 1-[(3-bromo-5-fluorophenyl)methyl]piperidine-3-carboxylate.
| Compound Name | methyl 1-[(3-bromo-5-fluorophenyl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 79673422 |
| Molecular Formula | C14H17BrFNO2 |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | methyl 1-[(3-bromo-5-fluorophenyl)methyl]piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(Cc2cc(F)cc(Br)c2)C1 |
| InChI | InChI=1S/C14H17BrFNO2/c1-19-14(18)11-3-2-4-17(9-11)8-10-5-12(15)7-13(16)6-10/h5-7,11H,2-4,8-9H2,1H3 |
| InChIKey | LEOPAGYIAXBMLB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |