C13H17FN2O2 — CID 104956290
methyl 1-[(5-fluoro-3-pyridinyl)methyl]piperidine-3-carboxylate (PubChem CID 104956290) has the molecular formula C13H17FN2O2 and a molecular weight of 252.29 g/mol. Its IUPAC name is methyl 1-[(5-fluoro-3-pyridinyl)methyl]piperidine-3-carboxylate.
| Compound Name | methyl 1-[(5-fluoro-3-pyridinyl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 104956290 |
| Molecular Formula | C13H17FN2O2 |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | methyl 1-[(5-fluoro-3-pyridinyl)methyl]piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(Cc2cncc(F)c2)C1 |
| InChI | InChI=1S/C13H17FN2O2/c1-18-13(17)11-3-2-4-16(9-11)8-10-5-12(14)7-15-6-10/h5-7,11H,2-4,8-9H2,1H3 |
| InChIKey | VDDIAOWEBRCZOO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |