C21H25FN2O2 — CID 92984931
ethyl (3S)-1-[[5-(4-fluoro-3-methylphenyl)-3-pyridinyl]methyl]piperidine-3-carboxylate (PubChem CID 92984931) has the molecular formula C21H25FN2O2 and a molecular weight of 356.44 g/mol. Its IUPAC name is ethyl (3S)-1-[[5-(4-fluoro-3-methylphenyl)-3-pyridinyl]methyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[[5-(4-fluoro-3-methylphenyl)-3-pyridinyl]methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 92984931 |
| Molecular Formula | C21H25FN2O2 |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | ethyl (3S)-1-[[5-(4-fluoro-3-methylphenyl)-3-pyridinyl]methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(Cc2cncc(-c3ccc(F)c(C)c3)c2)C1 |
| InChI | InChI=1S/C21H25FN2O2/c1-3-26-21(25)18-5-4-8-24(14-18)13-16-10-19(12-23-11-16)17-6-7-20(22)15(2)9-17/h6-7,9-12,18H,3-5,8,13-14H2,1-2H3/t18-/m0/s1 |
| InChIKey | ADNYAUMAEGQLMA-SFHVURJKSA-N |
| XLogP | 3.97 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |