C20H23FN2O2 — CID 42851824
ethyl 1-[[5-(4-fluorophenyl)-3-pyridinyl]methyl]piperidine-2-carboxylate (PubChem CID 42851824) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is ethyl 1-[[5-(4-fluorophenyl)-3-pyridinyl]methyl]piperidine-2-carboxylate.
| Compound Name | ethyl 1-[[5-(4-fluorophenyl)-3-pyridinyl]methyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 42851824 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | ethyl 1-[[5-(4-fluorophenyl)-3-pyridinyl]methyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1Cc1cncc(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H23FN2O2/c1-2-25-20(24)19-5-3-4-10-23(19)14-15-11-17(13-22-12-15)16-6-8-18(21)9-7-16/h6-9,11-13,19H,2-5,10,14H2,1H3 |
| InChIKey | AOAUTIWKVZTQDA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |