C16H23FN2O2 — CID 115538699
ethyl 1-[[4-(aminomethyl)-2-fluorophenyl]methyl]piperidine-2-carboxylate (PubChem CID 115538699) has the molecular formula C16H23FN2O2 and a molecular weight of 294.37 g/mol. Its IUPAC name is ethyl 1-[[4-(aminomethyl)-2-fluorophenyl]methyl]piperidine-2-carboxylate.
| Compound Name | ethyl 1-[[4-(aminomethyl)-2-fluorophenyl]methyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 115538699 |
| Molecular Formula | C16H23FN2O2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | ethyl 1-[[4-(aminomethyl)-2-fluorophenyl]methyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1Cc1ccc(CN)cc1F |
| InChI | InChI=1S/C16H23FN2O2/c1-2-21-16(20)15-5-3-4-8-19(15)11-13-7-6-12(10-18)9-14(13)17/h6-7,9,15H,2-5,8,10-11,18H2,1H3 |
| InChIKey | LQUMOCBOEKTOOP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |