C14H17BrFNO2 — CID 62013058
ethyl 1-[(4-bromo-2-fluorophenyl)methyl]pyrrolidine-2-carboxylate (PubChem CID 62013058) has the molecular formula C14H17BrFNO2 and a molecular weight of 330.20 g/mol. Its IUPAC name is ethyl 1-[(4-bromo-2-fluorophenyl)methyl]pyrrolidine-2-carboxylate.
| Compound Name | ethyl 1-[(4-bromo-2-fluorophenyl)methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 62013058 |
| Molecular Formula | C14H17BrFNO2 |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | ethyl 1-[(4-bromo-2-fluorophenyl)methyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCN1Cc1ccc(Br)cc1F |
| InChI | InChI=1S/C14H17BrFNO2/c1-2-19-14(18)13-4-3-7-17(13)9-10-5-6-11(15)8-12(10)16/h5-6,8,13H,2-4,7,9H2,1H3 |
| InChIKey | UKPIVJLGLBRLNT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |