C14H22N4O2 — CID 62245302
ethyl 1-[(6-hydrazinyl-3-pyridinyl)methyl]piperidine-2-carboxylate (PubChem CID 62245302) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is ethyl 1-[(6-hydrazinyl-3-pyridinyl)methyl]piperidine-2-carboxylate.
| Compound Name | ethyl 1-[(6-hydrazinyl-3-pyridinyl)methyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 62245302 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | ethyl 1-[(6-hydrazinyl-3-pyridinyl)methyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1Cc1ccc(NN)nc1 |
| InChI | InChI=1S/C14H22N4O2/c1-2-20-14(19)12-5-3-4-8-18(12)10-11-6-7-13(17-15)16-9-11/h6-7,9,12H,2-5,8,10,15H2,1H3,(H,16,17) |
| InChIKey | DBDOHPBCXADFJQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|