C15H24N4 — CID 102728191
[5-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-2-pyridinyl]hydrazine (PubChem CID 102728191) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is [5-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-2-pyridinyl]hydrazine.
| Compound Name | [5-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 102728191 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | [5-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]-2-pyridinyl]hydrazine |
| SMILES | NNc1ccc(CN2CCC[C@H]3CCCC[C@H]32)cn1 |
| InChI | InChI=1S/C15H24N4/c16-18-15-8-7-12(10-17-15)11-19-9-3-5-13-4-1-2-6-14(13)19/h7-8,10,13-14H,1-6,9,11,16H2,(H,17,18)/t13-,14-/m1/s1 |
| InChIKey | XAGQMCWATWLKSO-ZIAGYGMSSA-N |
| XLogP | 2.52 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|