C15H23N3 — CID 82753407
[6-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylmethyl)-3-pyridinyl]methanamine (PubChem CID 82753407) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is [6-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylmethyl)-3-pyridinyl]methanamine.
| Compound Name | [6-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylmethyl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 82753407 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | [6-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylmethyl)-3-pyridinyl]methanamine |
| SMILES | NCc1ccc(CN2CCC3CCCCC32)nc1 |
| InChI | InChI=1S/C15H23N3/c16-9-12-5-6-14(17-10-12)11-18-8-7-13-3-1-2-4-15(13)18/h5-6,10,13,15H,1-4,7-9,11,16H2 |
| InChIKey | XOYXZQKHVVBAJE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |