C14H21N3O2S — CID 82751843
[6-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)-3-pyridinyl]methanamine (PubChem CID 82751843) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is [6-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)-3-pyridinyl]methanamine.
| Compound Name | [6-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 82751843 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | [6-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)-3-pyridinyl]methanamine |
| SMILES | NCc1ccc(S(=O)(=O)N2CCC3CCCCC32)nc1 |
| InChI | InChI=1S/C14H21N3O2S/c15-9-11-5-6-14(16-10-11)20(18,19)17-8-7-12-3-1-2-4-13(12)17/h5-6,10,12-13H,1-4,7-9,15H2 |
| InChIKey | TVSWYBJVZOZHFT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |