C14H21ClN2O2S — CID 104692863
1-[[5-(chloromethyl)-2-pyridinyl]sulfonyl]-2-ethylazepane (PubChem CID 104692863) has the molecular formula C14H21ClN2O2S and a molecular weight of 316.85 g/mol. Its IUPAC name is 1-[[5-(chloromethyl)-2-pyridinyl]sulfonyl]-2-ethylazepane.
| Compound Name | 1-[[5-(chloromethyl)-2-pyridinyl]sulfonyl]-2-ethylazepane |
|---|---|
| PubChem CID | 104692863 |
| Molecular Formula | C14H21ClN2O2S |
| Molecular Weight | 316.85 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 1-[[5-(chloromethyl)-2-pyridinyl]sulfonyl]-2-ethylazepane |
| SMILES | CCC1CCCCCN1S(=O)(=O)c1ccc(CCl)cn1 |
| InChI | InChI=1S/C14H21ClN2O2S/c1-2-13-6-4-3-5-9-17(13)20(18,19)14-8-7-12(10-15)11-16-14/h7-8,11,13H,2-6,9-10H2,1H3 |
| InChIKey | OLAWZZTYUJKVJT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.85 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|