C15H22N2O2S — CID 65319523
[4-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylsulfonyl)phenyl]methanamine (PubChem CID 65319523) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is [4-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylsulfonyl)phenyl]methanamine.
| Compound Name | [4-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylsulfonyl)phenyl]methanamine |
|---|---|
| PubChem CID | 65319523 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | [4-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylsulfonyl)phenyl]methanamine |
| SMILES | NCc1ccc(S(=O)(=O)N2CCCC3CCCC32)cc1 |
| InChI | InChI=1S/C15H22N2O2S/c16-11-12-6-8-14(9-7-12)20(18,19)17-10-2-4-13-3-1-5-15(13)17/h6-9,13,15H,1-5,10-11,16H2 |
| InChIKey | OOKAYBSAGLWIQL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |