C15H21FN2O2S — CID 65319473
[2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylsulfonyl)-6-fluorophenyl]methanamine (PubChem CID 65319473) has the molecular formula C15H21FN2O2S and a molecular weight of 312.41 g/mol. Its IUPAC name is [2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylsulfonyl)-6-fluorophenyl]methanamine.
| Compound Name | [2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylsulfonyl)-6-fluorophenyl]methanamine |
|---|---|
| PubChem CID | 65319473 |
| Molecular Formula | C15H21FN2O2S |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | [2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylsulfonyl)-6-fluorophenyl]methanamine |
| SMILES | NCc1c(F)cccc1S(=O)(=O)N1CCCC2CCCC21 |
| InChI | InChI=1S/C15H21FN2O2S/c16-13-6-2-8-15(12(13)10-17)21(19,20)18-9-3-5-11-4-1-7-14(11)18/h2,6,8,11,14H,1,3-5,7,9-10,17H2 |
| InChIKey | VUNVMOIWZDZIBJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |