C15H23N3O2S — CID 43628435
[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylsulfonyl)phenyl]hydrazine (PubChem CID 43628435) has the molecular formula C15H23N3O2S and a molecular weight of 309.43 g/mol. Its IUPAC name is [2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylsulfonyl)phenyl]hydrazine.
| Compound Name | [2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylsulfonyl)phenyl]hydrazine |
|---|---|
| PubChem CID | 43628435 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | [2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylsulfonyl)phenyl]hydrazine |
| SMILES | NNc1ccccc1S(=O)(=O)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C15H23N3O2S/c16-17-13-8-2-4-10-15(13)21(19,20)18-11-5-7-12-6-1-3-9-14(12)18/h2,4,8,10,12,14,17H,1,3,5-7,9,11,16H2 |
| InChIKey | RLJLIQPEWBDIKC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|