C16H24N2O2S — CID 82752347
2-[4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)phenyl]ethanamine (PubChem CID 82752347) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is 2-[4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)phenyl]ethanamine.
| Compound Name | 2-[4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 82752347 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-[4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)phenyl]ethanamine |
| SMILES | NCCc1ccc(S(=O)(=O)N2CCC3CCCCC32)cc1 |
| InChI | InChI=1S/C16H24N2O2S/c17-11-9-13-5-7-15(8-6-13)21(19,20)18-12-10-14-3-1-2-4-16(14)18/h5-8,14,16H,1-4,9-12,17H2 |
| InChIKey | JGXLAXSFMSIOKK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |