C14H19NO3S — CID 82751077
3-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)phenol (PubChem CID 82751077) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 3-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)phenol.
| Compound Name | 3-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)phenol |
|---|---|
| PubChem CID | 82751077 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 3-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylsulfonyl)phenol |
| SMILES | O=S(=O)(c1cccc(O)c1)N1CCC2CCCCC21 |
| InChI | InChI=1S/C14H19NO3S/c16-12-5-3-6-13(10-12)19(17,18)15-9-8-11-4-1-2-7-14(11)15/h3,5-6,10-11,14,16H,1-2,4,7-9H2 |
| InChIKey | WZJHDIBFZWFAFF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |