C10H13NO5S — CID 106670534
1-(3-hydroxyphenyl)sulfonylpyrrolidine-3,4-diol (PubChem CID 106670534) has the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. Its IUPAC name is 1-(3-hydroxyphenyl)sulfonylpyrrolidine-3,4-diol.
| Compound Name | 1-(3-hydroxyphenyl)sulfonylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106670534 |
| Molecular Formula | C10H13NO5S |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 1-(3-hydroxyphenyl)sulfonylpyrrolidine-3,4-diol |
| SMILES | O=S(=O)(c1cccc(O)c1)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C10H13NO5S/c12-7-2-1-3-8(4-7)17(15,16)11-5-9(13)10(14)6-11/h1-4,9-10,12-14H,5-6H2 |
| InChIKey | IRBVPHHVPAAYAS-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |