C11H16N2O4S — CID 106668585
1-[3-(aminomethyl)phenyl]sulfonylpyrrolidine-3,4-diol (PubChem CID 106668585) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is 1-[3-(aminomethyl)phenyl]sulfonylpyrrolidine-3,4-diol.
| Compound Name | 1-[3-(aminomethyl)phenyl]sulfonylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106668585 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 1-[3-(aminomethyl)phenyl]sulfonylpyrrolidine-3,4-diol |
| SMILES | NCc1cccc(S(=O)(=O)N2CC(O)C(O)C2)c1 |
| InChI | InChI=1S/C11H16N2O4S/c12-5-8-2-1-3-9(4-8)18(16,17)13-6-10(14)11(15)7-13/h1-4,10-11,14-15H,5-7,12H2 |
| InChIKey | JCHCBPIFBZRGLM-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |