C12H17NO5S — CID 106672758
1-[3-(1-hydroxyethyl)phenyl]sulfonylpyrrolidine-3,4-diol (PubChem CID 106672758) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is 1-[3-(1-hydroxyethyl)phenyl]sulfonylpyrrolidine-3,4-diol.
| Compound Name | 1-[3-(1-hydroxyethyl)phenyl]sulfonylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106672758 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 1-[3-(1-hydroxyethyl)phenyl]sulfonylpyrrolidine-3,4-diol |
| SMILES | CC(O)c1cccc(S(=O)(=O)N2CC(O)C(O)C2)c1 |
| InChI | InChI=1S/C12H17NO5S/c1-8(14)9-3-2-4-10(5-9)19(17,18)13-6-11(15)12(16)7-13/h2-5,8,11-12,14-16H,6-7H2,1H3 |
| InChIKey | XTLUXJNNTFJIMZ-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |