C15H23NO4S — CID 102635778
N-(2-hydroxycyclohexyl)-3-(1-hydroxyethyl)-N-methylbenzenesulfonamide (PubChem CID 102635778) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is N-(2-hydroxycyclohexyl)-3-(1-hydroxyethyl)-N-methylbenzenesulfonamide.
| Compound Name | N-(2-hydroxycyclohexyl)-3-(1-hydroxyethyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102635778 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N-(2-hydroxycyclohexyl)-3-(1-hydroxyethyl)-N-methylbenzenesulfonamide |
| SMILES | CC(O)c1cccc(S(=O)(=O)N(C)C2CCCCC2O)c1 |
| InChI | InChI=1S/C15H23NO4S/c1-11(17)12-6-5-7-13(10-12)21(19,20)16(2)14-8-3-4-9-15(14)18/h5-7,10-11,14-15,17-18H,3-4,8-9H2,1-2H3 |
| InChIKey | UIEISZZKXQFVIF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |