C14H21NO4S — CID 124758353
N-[(1S,2R)-2-hydroxycyclohexyl]-4-methoxy-N-methylbenzenesulfonamide (PubChem CID 124758353) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is N-[(1S,2R)-2-hydroxycyclohexyl]-4-methoxy-N-methylbenzenesulfonamide.
| Compound Name | N-[(1S,2R)-2-hydroxycyclohexyl]-4-methoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 124758353 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N-[(1S,2R)-2-hydroxycyclohexyl]-4-methoxy-N-methylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)[C@H]2CCCC[C@H]2O)cc1 |
| InChI | InChI=1S/C14H21NO4S/c1-15(13-5-3-4-6-14(13)16)20(17,18)12-9-7-11(19-2)8-10-12/h7-10,13-14,16H,3-6H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | YJGRYXXOBIIVQU-UONOGXRCSA-N |
| XLogP | 1.62 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |