C21H28N2O6S — CID 70098521
cis-(1S,2R)-2-[benzyl-(4-methoxyphenyl)sulfonylamino]cyclohexane-1-carboxylic acid;hydroxylamine (PubChem CID 70098521) has the molecular formula C21H28N2O6S and a molecular weight of 436.53 g/mol. Its IUPAC name is cis-(1S,2R)-2-[benzyl-(4-methoxyphenyl)sulfonylamino]cyclohexane-1-carboxylic acid;hydroxylamine.
| Compound Name | cis-(1S,2R)-2-[benzyl-(4-methoxyphenyl)sulfonylamino]cyclohexane-1-carboxylic acid;hydroxylamine |
|---|---|
| PubChem CID | 70098521 |
| Molecular Formula | C21H28N2O6S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | cis-(1S,2R)-2-[benzyl-(4-methoxyphenyl)sulfonylamino]cyclohexane-1-carboxylic acid;hydroxylamine |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccccc2)[C@@H]2CCCC[C@@H]2C(=O)O)cc1.NO |
| InChI | InChI=1S/C21H25NO5S.H3NO/c1-27-17-11-13-18(14-12-17)28(25,26)22(15-16-7-3-2-4-8-16)20-10-6-5-9-19(20)21(23)24;1-2/h2-4,7-8,11-14,19-20H,5-6,9-10,15H2,1H3,(H,23,24);2H,1H2/t19-,20+;/m0./s1 |
| InChIKey | VZTNCMLACIESEJ-CMXBXVFLSA-N |
| XLogP | 2.86 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|