C23H29NO6S — CID 54455403
benzyl (2R)-2-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(4-methylcyclohexyl)amino]acetate (PubChem CID 54455403) has the molecular formula C23H29NO6S and a molecular weight of 447.55 g/mol. Its IUPAC name is benzyl (2R)-2-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(4-methylcyclohexyl)amino]acetate.
| Compound Name | benzyl (2R)-2-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(4-methylcyclohexyl)amino]acetate |
|---|---|
| PubChem CID | 54455403 |
| Molecular Formula | C23H29NO6S |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | benzyl (2R)-2-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(4-methylcyclohexyl)amino]acetate |
| SMILES | COc1ccc(S(=O)(=O)N(C2CCC(C)CC2)[C@H](O)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H29NO6S/c1-17-8-10-19(11-9-17)24(31(27,28)21-14-12-20(29-2)13-15-21)22(25)23(26)30-16-18-6-4-3-5-7-18/h3-7,12-15,17,19,22,25H,8-11,16H2,1-2H3/t17?,19?,22-/m1/s1 |
| InChIKey | WXVYCSIXUKTBHY-RKOYOZNISA-N |
| XLogP | 3.33 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|