C15H23NO4S — CID 110125865
N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]-N,4-dimethylbenzenesulfonamide (PubChem CID 110125865) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 110125865 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)[C@@H]2CCCC[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C15H23NO4S/c1-11-7-9-12(10-8-11)21(19,20)16(2)13-5-3-4-6-14(17)15(13)18/h7-10,13-15,17-18H,3-6H2,1-2H3/t13-,14-,15-/m1/s1 |
| InChIKey | JZDVTHWOGHYHKJ-RBSFLKMASA-N |
| XLogP | 1.28 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |