C22H27FN2O4S — CID 43896648
2-(N-(4-fluorophenyl)sulfonyl-4-methylanilino)-N-(2-hydroxycyclohexyl)-N-methylacetamide (PubChem CID 43896648) has the molecular formula C22H27FN2O4S and a molecular weight of 434.53 g/mol. Its IUPAC name is 2-(N-(4-fluorophenyl)sulfonyl-4-methylanilino)-N-(2-hydroxycyclohexyl)-N-methylacetamide.
| Compound Name | 2-(N-(4-fluorophenyl)sulfonyl-4-methylanilino)-N-(2-hydroxycyclohexyl)-N-methylacetamide |
|---|---|
| PubChem CID | 43896648 |
| Molecular Formula | C22H27FN2O4S |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 2-(N-(4-fluorophenyl)sulfonyl-4-methylanilino)-N-(2-hydroxycyclohexyl)-N-methylacetamide |
| SMILES | Cc1ccc(N(CC(=O)N(C)C2CCCCC2O)S(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H27FN2O4S/c1-16-7-11-18(12-8-16)25(30(28,29)19-13-9-17(23)10-14-19)15-22(27)24(2)20-5-3-4-6-21(20)26/h7-14,20-21,26H,3-6,15H2,1-2H3 |
| InChIKey | DWADEIHLALPTJC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |