C21H25BrN2O3S — CID 28633740
2-(4-bromo-N-(4-methylphenyl)sulfonylanilino)-N-cyclopentyl-N-methylacetamide (PubChem CID 28633740) has the molecular formula C21H25BrN2O3S and a molecular weight of 465.41 g/mol. Its IUPAC name is 2-(4-bromo-N-(4-methylphenyl)sulfonylanilino)-N-cyclopentyl-N-methylacetamide.
| Compound Name | 2-(4-bromo-N-(4-methylphenyl)sulfonylanilino)-N-cyclopentyl-N-methylacetamide |
|---|---|
| PubChem CID | 28633740 |
| Molecular Formula | C21H25BrN2O3S |
| Molecular Weight | 465.41 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 2-(4-bromo-N-(4-methylphenyl)sulfonylanilino)-N-cyclopentyl-N-methylacetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)N(C)C2CCCC2)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C21H25BrN2O3S/c1-16-7-13-20(14-8-16)28(26,27)24(19-11-9-17(22)10-12-19)15-21(25)23(2)18-5-3-4-6-18/h7-14,18H,3-6,15H2,1-2H3 |
| InChIKey | MDVVOWJEJAUTTP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |