C23H29BrN2O5S — CID 43897196
2-(N-(4-bromophenyl)sulfonyl-4-ethoxyanilino)-N-(2-hydroxycyclohexyl)-N-methylacetamide (PubChem CID 43897196) has the molecular formula C23H29BrN2O5S and a molecular weight of 525.47 g/mol. Its IUPAC name is 2-(N-(4-bromophenyl)sulfonyl-4-ethoxyanilino)-N-(2-hydroxycyclohexyl)-N-methylacetamide.
| Compound Name | 2-(N-(4-bromophenyl)sulfonyl-4-ethoxyanilino)-N-(2-hydroxycyclohexyl)-N-methylacetamide |
|---|---|
| PubChem CID | 43897196 |
| Molecular Formula | C23H29BrN2O5S |
| Molecular Weight | 525.47 g/mol |
| Exact Mass | 524.10 |
| IUPAC Name | 2-(N-(4-bromophenyl)sulfonyl-4-ethoxyanilino)-N-(2-hydroxycyclohexyl)-N-methylacetamide |
| SMILES | CCOc1ccc(N(CC(=O)N(C)C2CCCCC2O)S(=O)(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C23H29BrN2O5S/c1-3-31-19-12-10-18(11-13-19)26(32(29,30)20-14-8-17(24)9-15-20)16-23(28)25(2)21-6-4-5-7-22(21)27/h8-15,21-22,27H,3-7,16H2,1-2H3 |
| InChIKey | BRAJLPDOWDQCHI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |