C23H30N2O5S — CID 43894224
N-(2-hydroxycyclohexyl)-2-(3-methoxy-N-(4-methylphenyl)sulfonylanilino)-N-methylacetamide (PubChem CID 43894224) has the molecular formula C23H30N2O5S and a molecular weight of 446.57 g/mol. Its IUPAC name is N-(2-hydroxycyclohexyl)-2-(3-methoxy-N-(4-methylphenyl)sulfonylanilino)-N-methylacetamide.
| Compound Name | N-(2-hydroxycyclohexyl)-2-(3-methoxy-N-(4-methylphenyl)sulfonylanilino)-N-methylacetamide |
|---|---|
| PubChem CID | 43894224 |
| Molecular Formula | C23H30N2O5S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | N-(2-hydroxycyclohexyl)-2-(3-methoxy-N-(4-methylphenyl)sulfonylanilino)-N-methylacetamide |
| SMILES | COc1cccc(N(CC(=O)N(C)C2CCCCC2O)S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C23H30N2O5S/c1-17-11-13-20(14-12-17)31(28,29)25(18-7-6-8-19(15-18)30-3)16-23(27)24(2)21-9-4-5-10-22(21)26/h6-8,11-15,21-22,26H,4-5,9-10,16H2,1-3H3 |
| InChIKey | INKUYXJVLVYWJZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |