C14H21NO4S — CID 110125809
N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]-4-methylbenzenesulfonamide (PubChem CID 110125809) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 110125809 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N-[(1R,2R,3R)-2,3-dihydroxycycloheptyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C14H21NO4S/c1-10-6-8-11(9-7-10)20(18,19)15-12-4-2-3-5-13(16)14(12)17/h6-9,12-17H,2-5H2,1H3/t12-,13-,14-/m1/s1 |
| InChIKey | BHDCXLHUAVOJEB-MGPQQGTHSA-N |
| XLogP | 0.94 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |