C19H24N2O2S — CID 1121471
N-[(1R,2R)-2-(4-methylanilino)cyclohexyl]benzenesulfonamide (PubChem CID 1121471) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is N-[(1R,2R)-2-(4-methylanilino)cyclohexyl]benzenesulfonamide.
| Compound Name | N-[(1R,2R)-2-(4-methylanilino)cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 1121471 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | N-[(1R,2R)-2-(4-methylanilino)cyclohexyl]benzenesulfonamide |
| SMILES | Cc1ccc(N[C@@H]2CCCC[C@H]2NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H24N2O2S/c1-15-11-13-16(14-12-15)20-18-9-5-6-10-19(18)21-24(22,23)17-7-3-2-4-8-17/h2-4,7-8,11-14,18-21H,5-6,9-10H2,1H3/t18-,19-/m1/s1 |
| InChIKey | HPCQMYRPVJZNTR-RTBURBONSA-N |
| XLogP | 3.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |