C12H17NO3S — CID 11230584
N-[(1R,2R)-2-hydroxycyclopentyl]-4-methylbenzenesulfonamide (PubChem CID 11230584) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxycyclopentyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R,2R)-2-hydroxycyclopentyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11230584 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N-[(1R,2R)-2-hydroxycyclopentyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2CCC[C@H]2O)cc1 |
| InChI | InChI=1S/C12H17NO3S/c1-9-5-7-10(8-6-9)17(15,16)13-11-3-2-4-12(11)14/h5-8,11-14H,2-4H2,1H3/t11-,12-/m1/s1 |
| InChIKey | PJVVJWHZPJRXPW-VXGBXAGGSA-N |
| XLogP | 1.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |