C13H18BrNO2S — CID 106367542
N-[2-(bromomethyl)cyclopentyl]-4-methylbenzenesulfonamide (PubChem CID 106367542) has the molecular formula C13H18BrNO2S and a molecular weight of 332.26 g/mol. Its IUPAC name is N-[2-(bromomethyl)cyclopentyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-(bromomethyl)cyclopentyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106367542 |
| Molecular Formula | C13H18BrNO2S |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | N-[2-(bromomethyl)cyclopentyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2CCCC2CBr)cc1 |
| InChI | InChI=1S/C13H18BrNO2S/c1-10-5-7-12(8-6-10)18(16,17)15-13-4-2-3-11(13)9-14/h5-8,11,13,15H,2-4,9H2,1H3 |
| InChIKey | BTTWLORTUZTPHN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|