C20H33NO2SSi — CID 102463281
4-methyl-N-[(1R,2R)-2-[(E)-4-trimethylsilylbut-2-enyl]cyclohexyl]benzenesulfonamide (PubChem CID 102463281) has the molecular formula C20H33NO2SSi and a molecular weight of 379.64 g/mol. Its IUPAC name is 4-methyl-N-[(1R,2R)-2-[(E)-4-trimethylsilylbut-2-enyl]cyclohexyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(1R,2R)-2-[(E)-4-trimethylsilylbut-2-enyl]cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 102463281 |
| Molecular Formula | C20H33NO2SSi |
| Molecular Weight | 379.64 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 4-methyl-N-[(1R,2R)-2-[(E)-4-trimethylsilylbut-2-enyl]cyclohexyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@@H]2C/C=C/C[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C20H33NO2SSi/c1-17-12-14-19(15-13-17)24(22,23)21-20-11-6-5-9-18(20)10-7-8-16-25(2,3)4/h7-8,12-15,18,20-21H,5-6,9-11,16H2,1-4H3/b8-7+/t18-,20-/m1/s1 |
| InChIKey | UVVJIAHIONJZKZ-PORCLINASA-N |
| XLogP | 5.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.64 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|