C20H25NO4S2 — CID 25015867
4-methyl-N-[(1R,2R)-2-(4-methylphenyl)sulfonylcyclohexyl]benzenesulfonamide (PubChem CID 25015867) has the molecular formula C20H25NO4S2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 4-methyl-N-[(1R,2R)-2-(4-methylphenyl)sulfonylcyclohexyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(1R,2R)-2-(4-methylphenyl)sulfonylcyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25015867 |
| Molecular Formula | C20H25NO4S2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 4-methyl-N-[(1R,2R)-2-(4-methylphenyl)sulfonylcyclohexyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@H]2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H25NO4S2/c1-15-7-11-17(12-8-15)26(22,23)20-6-4-3-5-19(20)21-27(24,25)18-13-9-16(2)10-14-18/h7-14,19-21H,3-6H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | LDDPGWVNSRQEID-WOJBJXKFSA-N |
| XLogP | 3.37 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |