C14H21NO2S — CID 11097522
4-methyl-N-[(1S,2S)-2-methylcyclohexyl]benzenesulfonamide (PubChem CID 11097522) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 4-methyl-N-[(1S,2S)-2-methylcyclohexyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(1S,2S)-2-methylcyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11097522 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 4-methyl-N-[(1S,2S)-2-methylcyclohexyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H]2CCCC[C@@H]2C)cc1 |
| InChI | InChI=1S/C14H21NO2S/c1-11-7-9-13(10-8-11)18(16,17)15-14-6-4-3-5-12(14)2/h7-10,12,14-15H,3-6H2,1-2H3/t12-,14-/m0/s1 |
| InChIKey | ZQRNOIJLBIHHLN-JSGCOSHPSA-N |
| XLogP | 2.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |