C19H26N2O2RuS — CID 87792352
N-[(1S,2S)-2-aminocyclohexyl]-4-methylbenzenesulfonamide;benzene;ruthenium (PubChem CID 87792352) has the molecular formula C19H26N2O2RuS and a molecular weight of 447.57 g/mol. Its IUPAC name is N-[(1S,2S)-2-aminocyclohexyl]-4-methylbenzenesulfonamide;benzene;ruthenium.
| Compound Name | N-[(1S,2S)-2-aminocyclohexyl]-4-methylbenzenesulfonamide;benzene;ruthenium |
|---|---|
| PubChem CID | 87792352 |
| Molecular Formula | C19H26N2O2RuS |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | N-[(1S,2S)-2-aminocyclohexyl]-4-methylbenzenesulfonamide;benzene;ruthenium |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H]2CCCC[C@@H]2N)cc1.[Ru].c1ccccc1 |
| InChI | InChI=1S/C13H20N2O2S.C6H6.Ru/c1-10-6-8-11(9-7-10)18(16,17)15-13-5-3-2-4-12(13)14;1-2-4-6-5-3-1;/h6-9,12-13,15H,2-5,14H2,1H3;1-6H;/t12-,13-;;/m0../s1 |
| InChIKey | NJGKMKFKBCZDIB-NJHZPMQHSA-N |
| XLogP | 3.23 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |