C24H34N4O4S4 — CID 58915457
N-[(1R,2R)-2-aminocyclohexyl]-4-[[4-[[(1S,2S)-2-aminocyclohexyl]sulfamoyl]phenyl]disulfanyl]benzenesulfonamide (PubChem CID 58915457) has the molecular formula C24H34N4O4S4 and a molecular weight of 570.83 g/mol. Its IUPAC name is N-[(1R,2R)-2-aminocyclohexyl]-4-[[4-[[(1S,2S)-2-aminocyclohexyl]sulfamoyl]phenyl]disulfanyl]benzenesulfonamide.
| Compound Name | N-[(1R,2R)-2-aminocyclohexyl]-4-[[4-[[(1S,2S)-2-aminocyclohexyl]sulfamoyl]phenyl]disulfanyl]benzenesulfonamide |
|---|---|
| PubChem CID | 58915457 |
| Molecular Formula | C24H34N4O4S4 |
| Molecular Weight | 570.83 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | N-[(1R,2R)-2-aminocyclohexyl]-4-[[4-[[(1S,2S)-2-aminocyclohexyl]sulfamoyl]phenyl]disulfanyl]benzenesulfonamide |
| SMILES | N[C@@H]1CCCC[C@H]1NS(=O)(=O)c1ccc(SSc2ccc(S(=O)(=O)N[C@H]3CCCC[C@@H]3N)cc2)cc1 |
| InChI | InChI=1S/C24H34N4O4S4/c25-21-5-1-3-7-23(21)27-35(29,30)19-13-9-17(10-14-19)33-34-18-11-15-20(16-12-18)36(31,32)28-24-8-4-2-6-22(24)26/h9-16,21-24,27-28H,1-8,25-26H2/t21-,22+,23-,24+ |
| InChIKey | UKFVFOQHNFJSDO-WAPCQROESA-N |
| XLogP | 3.58 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.83 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|