C11H14Cl2N2O2S — CID 63252169
N-(2-aminocyclopentyl)-3,4-dichlorobenzenesulfonamide (PubChem CID 63252169) has the molecular formula C11H14Cl2N2O2S and a molecular weight of 309.22 g/mol. Its IUPAC name is N-(2-aminocyclopentyl)-3,4-dichlorobenzenesulfonamide.
| Compound Name | N-(2-aminocyclopentyl)-3,4-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 63252169 |
| Molecular Formula | C11H14Cl2N2O2S |
| Molecular Weight | 309.22 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | N-(2-aminocyclopentyl)-3,4-dichlorobenzenesulfonamide |
| SMILES | NC1CCCC1NS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2N2O2S/c12-8-5-4-7(6-9(8)13)18(16,17)15-11-3-1-2-10(11)14/h4-6,10-11,15H,1-3,14H2 |
| InChIKey | JUUCLPUXPDXWMJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.22 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |