C12H19N3O4S2 — CID 61037249
3-N-(2-aminocyclohexyl)benzene-1,3-disulfonamide (PubChem CID 61037249) has the molecular formula C12H19N3O4S2 and a molecular weight of 333.44 g/mol. Its IUPAC name is 3-N-(2-aminocyclohexyl)benzene-1,3-disulfonamide.
| Compound Name | 3-N-(2-aminocyclohexyl)benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 61037249 |
| Molecular Formula | C12H19N3O4S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 3-N-(2-aminocyclohexyl)benzene-1,3-disulfonamide |
| SMILES | NC1CCCCC1NS(=O)(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H19N3O4S2/c13-11-6-1-2-7-12(11)15-21(18,19)10-5-3-4-9(8-10)20(14,16)17/h3-5,8,11-12,15H,1-2,6-7,13H2,(H2,14,16,17) |
| InChIKey | CNTPEAWNKDPJDJ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |